C19H25NO2 — CID 53376316
(3S,4R)-N-(furan-2-ylmethyl)-4-(phenylmethoxymethyl)hex-1-en-3-amine (PubChem CID 53376316) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (3S,4R)-N-(furan-2-ylmethyl)-4-(phenylmethoxymethyl)hex-1-en-3-amine.
| Compound Name | (3S,4R)-N-(furan-2-ylmethyl)-4-(phenylmethoxymethyl)hex-1-en-3-amine |
|---|---|
| PubChem CID | 53376316 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (3S,4R)-N-(furan-2-ylmethyl)-4-(phenylmethoxymethyl)hex-1-en-3-amine |
| SMILES | C=C[C@H](NCc1ccco1)[C@@H](CC)COCc1ccccc1 |
| InChI | InChI=1S/C19H25NO2/c1-3-17(15-21-14-16-9-6-5-7-10-16)19(4-2)20-13-18-11-8-12-22-18/h4-12,17,19-20H,2-3,13-15H2,1H3/t17-,19-/m0/s1 |
| InChIKey | DDVXPEKSLFUDCT-HKUYNNGSSA-N |
| XLogP | 4.17 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|