C23H26Cl3NO2 — CID 53376415
N-benzyl-2,2,2-trichloro-N-[(3S,4S)-4-(phenylmethoxymethyl)hex-1-en-3-yl]acetamide (PubChem CID 53376415) has the molecular formula C23H26Cl3NO2 and a molecular weight of 454.83 g/mol. Its IUPAC name is N-benzyl-2,2,2-trichloro-N-[(3S,4S)-4-(phenylmethoxymethyl)hex-1-en-3-yl]acetamide.
| Compound Name | N-benzyl-2,2,2-trichloro-N-[(3S,4S)-4-(phenylmethoxymethyl)hex-1-en-3-yl]acetamide |
|---|---|
| PubChem CID | 53376415 |
| Molecular Formula | C23H26Cl3NO2 |
| Molecular Weight | 454.83 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | N-benzyl-2,2,2-trichloro-N-[(3S,4S)-4-(phenylmethoxymethyl)hex-1-en-3-yl]acetamide |
| SMILES | C=C[C@@H]([C@H](CC)COCc1ccccc1)N(Cc1ccccc1)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C23H26Cl3NO2/c1-3-20(17-29-16-19-13-9-6-10-14-19)21(4-2)27(22(28)23(24,25)26)15-18-11-7-5-8-12-18/h4-14,20-21H,2-3,15-17H2,1H3/t20-,21+/m1/s1 |
| InChIKey | LQPHDYVYUPTNPQ-RTWAWAEBSA-N |
| XLogP | 6.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.83 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|