C18H20FNO2S — CID 53377389
N-(cyclopropylmethyl)-N-[(4-fluorophenyl)methyl]-4-methylsulfonylaniline (PubChem CID 53377389) has the molecular formula C18H20FNO2S and a molecular weight of 333.43 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-[(4-fluorophenyl)methyl]-4-methylsulfonylaniline.
| Compound Name | N-(cyclopropylmethyl)-N-[(4-fluorophenyl)methyl]-4-methylsulfonylaniline |
|---|---|
| PubChem CID | 53377389 |
| Molecular Formula | C18H20FNO2S |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-(cyclopropylmethyl)-N-[(4-fluorophenyl)methyl]-4-methylsulfonylaniline |
| SMILES | CS(=O)(=O)c1ccc(N(Cc2ccc(F)cc2)CC2CC2)cc1 |
| InChI | InChI=1S/C18H20FNO2S/c1-23(21,22)18-10-8-17(9-11-18)20(12-14-2-3-14)13-15-4-6-16(19)7-5-15/h4-11,14H,2-3,12-13H2,1H3 |
| InChIKey | JJVWRXBYIMOUME-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |