C15H17FO2 — CID 53381416
[(4-fluorophenyl)-(2,3,3-trimethylcyclopropen-1-yl)methyl] acetate (PubChem CID 53381416) has the molecular formula C15H17FO2 and a molecular weight of 248.30 g/mol. Its IUPAC name is [(4-fluorophenyl)-(2,3,3-trimethylcyclopropen-1-yl)methyl] acetate.
| Compound Name | [(4-fluorophenyl)-(2,3,3-trimethylcyclopropen-1-yl)methyl] acetate |
|---|---|
| PubChem CID | 53381416 |
| Molecular Formula | C15H17FO2 |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | [(4-fluorophenyl)-(2,3,3-trimethylcyclopropen-1-yl)methyl] acetate |
| SMILES | CC(=O)OC(C1=C(C)C1(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H17FO2/c1-9-13(15(9,3)4)14(18-10(2)17)11-5-7-12(16)8-6-11/h5-8,14H,1-4H3 |
| InChIKey | NUFRFLDUGVDKDK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|