C17H21NO5 — CID 53381738
tert-butyl 3-(2-ethoxy-2-oxoethyl)-2-oxo-3H-indole-1-carboxylate (PubChem CID 53381738) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is tert-butyl 3-(2-ethoxy-2-oxoethyl)-2-oxo-3H-indole-1-carboxylate.
| Compound Name | tert-butyl 3-(2-ethoxy-2-oxoethyl)-2-oxo-3H-indole-1-carboxylate |
|---|---|
| PubChem CID | 53381738 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | tert-butyl 3-(2-ethoxy-2-oxoethyl)-2-oxo-3H-indole-1-carboxylate |
| SMILES | CCOC(=O)CC1C(=O)N(C(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C17H21NO5/c1-5-22-14(19)10-12-11-8-6-7-9-13(11)18(15(12)20)16(21)23-17(2,3)4/h6-9,12H,5,10H2,1-4H3 |
| InChIKey | AAKBGGVPUGBQSE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |