C26H28N4O5 — CID 53382835
methyl 6-amino-5-cyano-4-(2,3-dimethoxyphenyl)-1-(4-morpholin-4-ylphenyl)-4H-pyridine-3-carboxylate (PubChem CID 53382835) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is methyl 6-amino-5-cyano-4-(2,3-dimethoxyphenyl)-1-(4-morpholin-4-ylphenyl)-4H-pyridine-3-carboxylate.
| Compound Name | methyl 6-amino-5-cyano-4-(2,3-dimethoxyphenyl)-1-(4-morpholin-4-ylphenyl)-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 53382835 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | methyl 6-amino-5-cyano-4-(2,3-dimethoxyphenyl)-1-(4-morpholin-4-ylphenyl)-4H-pyridine-3-carboxylate |
| SMILES | COC(=O)C1=CN(c2ccc(N3CCOCC3)cc2)C(N)=C(C#N)C1c1cccc(OC)c1OC |
| InChI | InChI=1S/C26H28N4O5/c1-32-22-6-4-5-19(24(22)33-2)23-20(15-27)25(28)30(16-21(23)26(31)34-3)18-9-7-17(8-10-18)29-11-13-35-14-12-29/h4-10,16,23H,11-14,28H2,1-3H3 |
| InChIKey | DFBXRANNWRIBIF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|