C16H23N3O6S — CID 53382948
methyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-(prop-2-enoxycarbonylamino)-1,3-thiazole-5-carboxylate (PubChem CID 53382948) has the molecular formula C16H23N3O6S and a molecular weight of 385.44 g/mol. Its IUPAC name is methyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-(prop-2-enoxycarbonylamino)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-(prop-2-enoxycarbonylamino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 53382948 |
| Molecular Formula | C16H23N3O6S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | methyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-(prop-2-enoxycarbonylamino)-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)Nc1nc(CCNC(=O)OC(C)(C)C)c(C(=O)OC)s1 |
| InChI | InChI=1S/C16H23N3O6S/c1-6-9-24-15(22)19-13-18-10(11(26-13)12(20)23-5)7-8-17-14(21)25-16(2,3)4/h6H,1,7-9H2,2-5H3,(H,17,21)(H,18,19,22) |
| InChIKey | VNOSJPQJXZTNRM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|