C18H17Br2NO3 — CID 53387446
[3,5-bis(3-bromophenyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol (PubChem CID 53387446) has the molecular formula C18H17Br2NO3 and a molecular weight of 455.15 g/mol. Its IUPAC name is [3,5-bis(3-bromophenyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol.
| Compound Name | [3,5-bis(3-bromophenyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol |
|---|---|
| PubChem CID | 53387446 |
| Molecular Formula | C18H17Br2NO3 |
| Molecular Weight | 455.15 g/mol |
| Exact Mass | 452.96 |
| IUPAC Name | [3,5-bis(3-bromophenyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol |
| SMILES | OCC12COC(c3cccc(Br)c3)N1C(c1cccc(Br)c1)OC2 |
| InChI | InChI=1S/C18H17Br2NO3/c19-14-5-1-3-12(7-14)16-21-17(13-4-2-6-15(20)8-13)24-11-18(21,9-22)10-23-16/h1-8,16-17,22H,9-11H2 |
| InChIKey | NWMPJGUSGDEYBK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.15 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |