C22H20N2O3S — CID 53387732
5-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 53387732) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 5-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 5-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 53387732 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 5-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1cc(-c2nc(N)sc2-c2ccc3ccccc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H20N2O3S/c1-25-17-11-16(12-18(26-2)20(17)27-3)19-21(28-22(23)24-19)15-9-8-13-6-4-5-7-14(13)10-15/h4-12H,1-3H3,(H2,23,24) |
| InChIKey | AGBZOWINMPCODV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |