C10H16O7 — CID 53387863
prop-2-enyl 2-[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxy(2,3,4,5,6-13C5)oxan-2-yl]acetate (PubChem CID 53387863) has the molecular formula C10H16O7 and a molecular weight of 254.19 g/mol. Its IUPAC name is prop-2-enyl 2-[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxy(2,3,4,5,6-13C5)oxan-2-yl]acetate.
| Compound Name | prop-2-enyl 2-[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxy(2,3,4,5,6-13C5)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 53387863 |
| Molecular Formula | C10H16O7 |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | prop-2-enyl 2-[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxy(2,3,4,5,6-13C5)oxan-2-yl]acetate |
| SMILES | C=CCOC(=O)[13CH2][13C@H]1O[13C@@H](O)[13C@H](O)[13C@@H](O)[13C@@H]1O |
| InChI | InChI=1S/C10H16O7/c1-2-3-16-6(11)4-5-7(12)8(13)9(14)10(15)17-5/h2,5,7-10,12-15H,1,3-4H2/t5-,7-,8+,9-,10-/m1/s1/i4+1,5+1,7+1,8+1,9+1,10+1 |
| InChIKey | VYDVSGAWAUZCDX-JNSYLNHESA-N |
| XLogP | -2.09 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|