C16H24O7 — CID 146018814
methyl (2S,3S,4S,5R)-6-hydroxy-3,4,5-tris(prop-2-enoxy)oxane-2-carboxylate (PubChem CID 146018814) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R)-6-hydroxy-3,4,5-tris(prop-2-enoxy)oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R)-6-hydroxy-3,4,5-tris(prop-2-enoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 146018814 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | methyl (2S,3S,4S,5R)-6-hydroxy-3,4,5-tris(prop-2-enoxy)oxane-2-carboxylate |
| SMILES | C=CCO[C@H]1[C@H](OCC=C)[C@@H](OCC=C)C(O)O[C@@H]1C(=O)OC |
| InChI | InChI=1S/C16H24O7/c1-5-8-20-11-12(21-9-6-2)14(15(17)19-4)23-16(18)13(11)22-10-7-3/h5-7,11-14,16,18H,1-3,8-10H2,4H3/t11-,12-,13+,14-,16?/m0/s1 |
| InChIKey | PGYNSSVIJWNZDA-AKFOCJAPSA-N |
| XLogP | 0.59 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|