C21H28N2O3 — CID 53388213
methyl (2S)-2-[(2-carbamoyl-2-adamantyl)amino]-3-phenylpropanoate (PubChem CID 53388213) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is methyl (2S)-2-[(2-carbamoyl-2-adamantyl)amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[(2-carbamoyl-2-adamantyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 53388213 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | methyl (2S)-2-[(2-carbamoyl-2-adamantyl)amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC1(C(N)=O)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C21H28N2O3/c1-26-19(24)18(12-13-5-3-2-4-6-13)23-21(20(22)25)16-8-14-7-15(10-16)11-17(21)9-14/h2-6,14-18,23H,7-12H2,1H3,(H2,22,25)/t14?,15?,16?,17?,18-,21?/m0/s1 |
| InChIKey | JZGZXHCUAWMUAD-RSQNZQOJSA-N |
| XLogP | 2.04 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |