C21H29N3O4 — CID 53389146
2-(1-methyl-3,5-dioxo-1,4-diazaspiro[5.7]tridecan-4-yl)-N-phenylmethoxyacetamide (PubChem CID 53389146) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-(1-methyl-3,5-dioxo-1,4-diazaspiro[5.7]tridecan-4-yl)-N-phenylmethoxyacetamide.
| Compound Name | 2-(1-methyl-3,5-dioxo-1,4-diazaspiro[5.7]tridecan-4-yl)-N-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 53389146 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 2-(1-methyl-3,5-dioxo-1,4-diazaspiro[5.7]tridecan-4-yl)-N-phenylmethoxyacetamide |
| SMILES | CN1CC(=O)N(CC(=O)NOCc2ccccc2)C(=O)C12CCCCCCC2 |
| InChI | InChI=1S/C21H29N3O4/c1-23-15-19(26)24(20(27)21(23)12-8-3-2-4-9-13-21)14-18(25)22-28-16-17-10-6-5-7-11-17/h5-7,10-11H,2-4,8-9,12-16H2,1H3,(H,22,25) |
| InChIKey | LNYLGHXUHBBWTA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|