C11H21NOS2Zn — CID 53389928
zinc 8-oxo-8-(propan-2-ylamino)octane-1,3-dithiolate (PubChem CID 53389928) has the molecular formula C11H21NOS2Zn and a molecular weight of 312.82 g/mol. Its IUPAC name is zinc 8-oxo-8-(propan-2-ylamino)octane-1,3-dithiolate.
| Compound Name | zinc 8-oxo-8-(propan-2-ylamino)octane-1,3-dithiolate |
|---|---|
| PubChem CID | 53389928 |
| Molecular Formula | C11H21NOS2Zn |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | zinc 8-oxo-8-(propan-2-ylamino)octane-1,3-dithiolate |
| SMILES | CC(C)NC(=O)CCCCC([S-])CC[S-].[Zn+2] |
| InChI | InChI=1S/C11H23NOS2.Zn/c1-9(2)12-11(13)6-4-3-5-10(15)7-8-14;/h9-10,14-15H,3-8H2,1-2H3,(H,12,13);/q;+2/p-2 |
| InChIKey | QLXIDZUQNXSREO-UHFFFAOYSA-L |
| XLogP | 1.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|