C22H14Cl2N2O2 — CID 53391604
2,5-dichloro-4,6-bis[2-(3-methoxyphenyl)ethynyl]pyrimidine (PubChem CID 53391604) has the molecular formula C22H14Cl2N2O2 and a molecular weight of 409.27 g/mol. Its IUPAC name is 2,5-dichloro-4,6-bis[2-(3-methoxyphenyl)ethynyl]pyrimidine.
| Compound Name | 2,5-dichloro-4,6-bis[2-(3-methoxyphenyl)ethynyl]pyrimidine |
|---|---|
| PubChem CID | 53391604 |
| Molecular Formula | C22H14Cl2N2O2 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 2,5-dichloro-4,6-bis[2-(3-methoxyphenyl)ethynyl]pyrimidine |
| SMILES | COc1cccc(C#Cc2nc(Cl)nc(C#Cc3cccc(OC)c3)c2Cl)c1 |
| InChI | InChI=1S/C22H14Cl2N2O2/c1-27-17-7-3-5-15(13-17)9-11-19-21(23)20(26-22(24)25-19)12-10-16-6-4-8-18(14-16)28-2/h3-8,13-14H,1-2H3 |
| InChIKey | NSOMJMCOLDTFGJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|