C14H17N3O2S — CID 53397241
ethyl 3-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methylamino]propanoate (PubChem CID 53397241) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is ethyl 3-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methylamino]propanoate.
| Compound Name | ethyl 3-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methylamino]propanoate |
|---|---|
| PubChem CID | 53397241 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | ethyl 3-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methylamino]propanoate |
| SMILES | CCOC(=O)CCNCc1csc(-c2ccncc2)n1 |
| InChI | InChI=1S/C14H17N3O2S/c1-2-19-13(18)5-8-16-9-12-10-20-14(17-12)11-3-6-15-7-4-11/h3-4,6-7,10,16H,2,5,8-9H2,1H3 |
| InChIKey | CVJACFGFZMXWRU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|