C10H16N2 — CID 53402680
2-(3,5-dimethylphenyl)ethylhydrazine (PubChem CID 53402680) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)ethylhydrazine.
| Compound Name | 2-(3,5-dimethylphenyl)ethylhydrazine |
|---|---|
| PubChem CID | 53402680 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2-(3,5-dimethylphenyl)ethylhydrazine |
| SMILES | Cc1cc(C)cc(CCNN)c1 |
| InChI | InChI=1S/C10H16N2/c1-8-5-9(2)7-10(6-8)3-4-12-11/h5-7,12H,3-4,11H2,1-2H3 |
| InChIKey | NVFKUJFXTZFMCP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|