C10H14F2Si — CID 123598242
2-(3,5-dimethylphenyl)ethyl-difluorosilane (PubChem CID 123598242) has the molecular formula C10H14F2Si and a molecular weight of 200.30 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)ethyl-difluorosilane.
| Compound Name | 2-(3,5-dimethylphenyl)ethyl-difluorosilane |
|---|---|
| PubChem CID | 123598242 |
| Molecular Formula | C10H14F2Si |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 2-(3,5-dimethylphenyl)ethyl-difluorosilane |
| SMILES | Cc1cc(C)cc(CC[SiH](F)F)c1 |
| InChI | InChI=1S/C10H14F2Si/c1-8-5-9(2)7-10(6-8)3-4-13(11)12/h5-7,13H,3-4H2,1-2H3 |
| InChIKey | AZJKOOAXZYLMIJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|