C56H66 — CID 123805979
1,2,3,4,5-pentakis[2-(3,5-dimethylphenyl)ethyl]benzene (PubChem CID 123805979) has the molecular formula C56H66 and a molecular weight of 739.14 g/mol. Its IUPAC name is 1,2,3,4,5-pentakis[2-(3,5-dimethylphenyl)ethyl]benzene.
| Compound Name | 1,2,3,4,5-pentakis[2-(3,5-dimethylphenyl)ethyl]benzene |
|---|---|
| PubChem CID | 123805979 |
| Molecular Formula | C56H66 |
| Molecular Weight | 739.14 g/mol |
| Exact Mass | 738.52 |
| IUPAC Name | 1,2,3,4,5-pentakis[2-(3,5-dimethylphenyl)ethyl]benzene |
| SMILES | Cc1cc(C)cc(CCc2cc(CCc3cc(C)cc(C)c3)c(CCc3cc(C)cc(C)c3)c(CCc3cc(C)cc(C)c3)c2CCc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C56H66/c1-37-21-38(2)27-47(26-37)11-16-52-36-53(17-12-48-28-39(3)22-40(4)29-48)55(19-14-50-32-43(7)24-44(8)33-50)56(20-15-51-34-45(9)25-46(10)35-51)54(52)18-13-49-30-41(5)23-42(6)31-49/h21-36H,11-20H2,1-10H3 |
| InChIKey | YRYHQXCOLFFUTN-UHFFFAOYSA-N |
| XLogP | 13.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.14 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |