C12H18BrNO3S — CID 53406864
4-(2-bromo-1-hydroxyethyl)-N,N-diethylbenzenesulfonamide (PubChem CID 53406864) has the molecular formula C12H18BrNO3S and a molecular weight of 336.25 g/mol. Its IUPAC name is 4-(2-bromo-1-hydroxyethyl)-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-(2-bromo-1-hydroxyethyl)-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 53406864 |
| Molecular Formula | C12H18BrNO3S |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 4-(2-bromo-1-hydroxyethyl)-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(O)CBr)cc1 |
| InChI | InChI=1S/C12H18BrNO3S/c1-3-14(4-2)18(16,17)11-7-5-10(6-8-11)12(15)9-13/h5-8,12,15H,3-4,9H2,1-2H3 |
| InChIKey | XVFMODXEAUEWJG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|