C18H21ClN2O5 — CID 53408152
diethyl 2-[3-(6-chloro-1H-indol-2-yl)propanoylamino]propanedioate (PubChem CID 53408152) has the molecular formula C18H21ClN2O5 and a molecular weight of 380.83 g/mol. Its IUPAC name is diethyl 2-[3-(6-chloro-1H-indol-2-yl)propanoylamino]propanedioate.
| Compound Name | diethyl 2-[3-(6-chloro-1H-indol-2-yl)propanoylamino]propanedioate |
|---|---|
| PubChem CID | 53408152 |
| Molecular Formula | C18H21ClN2O5 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | diethyl 2-[3-(6-chloro-1H-indol-2-yl)propanoylamino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)CCc1cc2ccc(Cl)cc2[nH]1)C(=O)OCC |
| InChI | InChI=1S/C18H21ClN2O5/c1-3-25-17(23)16(18(24)26-4-2)21-15(22)8-7-13-9-11-5-6-12(19)10-14(11)20-13/h5-6,9-10,16,20H,3-4,7-8H2,1-2H3,(H,21,22) |
| InChIKey | ZFOBQCCKAYMCAU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|