About CID 53411194
CID 53411194 (PubChem CID 53411194) has the molecular formula C5H9ClSi
and a molecular weight of 132.67 g/mol.
Molecular Properties
| Compound Name | CID 53411194 |
| PubChem CID | 53411194 |
| Molecular Formula | C5H9ClSi |
| Molecular Weight | 132.67 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | — |
| SMILES | CC(C)=C[Si]CCl |
| InChI | InChI=1S/C5H9ClSi/c1-5(2)3-7-4-6/h3H,4H2,1-2H3 |
| InChIKey | MRWDZEWAZYTKIE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.67 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 53411194 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 53411194?
The IUPAC name of CID 53411194 (CID 53411194) is not available.
What is the SMILES notation for CID 53411194?
The canonical SMILES for CID 53411194 is CC(C)=C[Si]CCl.
What is the InChIKey of CID 53411194?
The InChIKey is MRWDZEWAZYTKIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClSi/c1-5(2)3-7-4-6/h3H,4H2,1-2H3.
What are the key properties of CID 53411194?
CID 53411194 has a molecular weight of 132.67 g/mol, XLogP of 1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 53411194 is sourced from PubChem (CID 53411194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).