C4H7N5 — CID 53424410
2-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 53424410) has the molecular formula C4H7N5 and a molecular weight of 125.13 g/mol. Its IUPAC name is 2-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 53424410 |
| Molecular Formula | C4H7N5 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.07 |
| IUPAC Name | 2-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1ncnc(N)n1 |
| InChI | InChI=1S/C4H7N5/c1-6-4-8-2-7-3(5)9-4/h2H,1H3,(H3,5,6,7,8,9) |
| InChIKey | AQNZPZXZLWGWMN-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |