C14H15ClNO5- — CID 53431403
3-[2-[(4-chlorophenyl)methyl]butanoylamino]oxy-3-oxopropanoate (PubChem CID 53431403) has the molecular formula C14H15ClNO5- and a molecular weight of 312.73 g/mol. Its IUPAC name is 3-[2-[(4-chlorophenyl)methyl]butanoylamino]oxy-3-oxopropanoate.
| Compound Name | 3-[2-[(4-chlorophenyl)methyl]butanoylamino]oxy-3-oxopropanoate |
|---|---|
| PubChem CID | 53431403 |
| Molecular Formula | C14H15ClNO5- |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 3-[2-[(4-chlorophenyl)methyl]butanoylamino]oxy-3-oxopropanoate |
| SMILES | CCC(Cc1ccc(Cl)cc1)C(=O)NOC(=O)CC(=O)[O-] |
| InChI | InChI=1S/C14H16ClNO5/c1-2-10(7-9-3-5-11(15)6-4-9)14(20)16-21-13(19)8-12(17)18/h3-6,10H,2,7-8H2,1H3,(H,16,20)(H,17,18)/p-1 |
| InChIKey | LDAFAKBKTPGDEH-UHFFFAOYSA-M |
| XLogP | 0.62 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|