C16H19ClNO5- — CID 57374913
3-[[2-[(4-chlorophenyl)methyl]-2-ethylbutanoyl]amino]oxy-3-oxopropanoate (PubChem CID 57374913) has the molecular formula C16H19ClNO5- and a molecular weight of 340.78 g/mol. Its IUPAC name is 3-[[2-[(4-chlorophenyl)methyl]-2-ethylbutanoyl]amino]oxy-3-oxopropanoate.
| Compound Name | 3-[[2-[(4-chlorophenyl)methyl]-2-ethylbutanoyl]amino]oxy-3-oxopropanoate |
|---|---|
| PubChem CID | 57374913 |
| Molecular Formula | C16H19ClNO5- |
| Molecular Weight | 340.78 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 3-[[2-[(4-chlorophenyl)methyl]-2-ethylbutanoyl]amino]oxy-3-oxopropanoate |
| SMILES | CCC(CC)(Cc1ccc(Cl)cc1)C(=O)NOC(=O)CC(=O)[O-] |
| InChI | InChI=1S/C16H20ClNO5/c1-3-16(4-2,10-11-5-7-12(17)8-6-11)15(22)18-23-14(21)9-13(19)20/h5-8H,3-4,9-10H2,1-2H3,(H,18,22)(H,19,20)/p-1 |
| InChIKey | HTHSHBCTTVGDIH-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.78 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|