About 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrate;hydrochloride
1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrate;hydrochloride (PubChem CID 53444633) has the molecular formula C12H16ClF3N4O
and a molecular weight of 324.73 g/mol. Its IUPAC name is 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrate;hydrochloride |
| PubChem CID | 53444633 |
| Molecular Formula | C12H16ClF3N4O |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrate;hydrochloride |
| SMILES | Cl.FC(F)(F)c1ccc2c(c1)nnn2C1CCNCC1.O |
| InChI | InChI=1S/C12H13F3N4.ClH.H2O/c13-12(14,15)8-1-2-11-10(7-8)17-18-19(11)9-3-5-16-6-4-9;;/h1-2,7,9,16H,3-6H2;1H;1H2 |
| InChIKey | NDNJPGZTYYDZSO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrate;hydrochloride?
The IUPAC name of 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrate;hydrochloride (CID 53444633) is 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrate;hydrochloride.
What is the SMILES notation for 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrate;hydrochloride?
The canonical SMILES for 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrate;hydrochloride is Cl.FC(F)(F)c1ccc2c(c1)nnn2C1CCNCC1.O.
What is the InChIKey of 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrate;hydrochloride?
The InChIKey is NDNJPGZTYYDZSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3N4.ClH.H2O/c13-12(14,15)8-1-2-11-10(7-8)17-18-19(11)9-3-5-16-6-4-9;;/h1-2,7,9,16H,3-6H2;1H;1H2.
What are the key properties of 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrate;hydrochloride?
1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrate;hydrochloride has a molecular weight of 324.73 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrate;hydrochloride is sourced from PubChem (CID 53444633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).