C21H22F3N4O2+ — CID 7436480
benzyl 2-[4-[5-(trifluoromethyl)benzotriazol-1-yl]piperidin-1-ium-1-yl]acetate (PubChem CID 7436480) has the molecular formula C21H22F3N4O2+ and a molecular weight of 419.43 g/mol. Its IUPAC name is benzyl 2-[4-[5-(trifluoromethyl)benzotriazol-1-yl]piperidin-1-ium-1-yl]acetate.
| Compound Name | benzyl 2-[4-[5-(trifluoromethyl)benzotriazol-1-yl]piperidin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 7436480 |
| Molecular Formula | C21H22F3N4O2+ |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | benzyl 2-[4-[5-(trifluoromethyl)benzotriazol-1-yl]piperidin-1-ium-1-yl]acetate |
| SMILES | O=C(C[NH+]1CCC(n2nnc3cc(C(F)(F)F)ccc32)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C21H21F3N4O2/c22-21(23,24)16-6-7-19-18(12-16)25-26-28(19)17-8-10-27(11-9-17)13-20(29)30-14-15-4-2-1-3-5-15/h1-7,12,17H,8-11,13-14H2/p+1 |
| InChIKey | NWWKLKBUBAHSHB-UHFFFAOYSA-O |
| XLogP | 2.41 |
| TPSA | 61.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |