C17H18N4O2S — CID 53461661
2-amino-N'-(2-oxo-2-phenothiazin-10-ylethyl)propanehydrazide (PubChem CID 53461661) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-amino-N'-(2-oxo-2-phenothiazin-10-ylethyl)propanehydrazide.
| Compound Name | 2-amino-N'-(2-oxo-2-phenothiazin-10-ylethyl)propanehydrazide |
|---|---|
| PubChem CID | 53461661 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-amino-N'-(2-oxo-2-phenothiazin-10-ylethyl)propanehydrazide |
| SMILES | CC(N)C(=O)NNCC(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C17H18N4O2S/c1-11(18)17(23)20-19-10-16(22)21-12-6-2-4-8-14(12)24-15-9-5-3-7-13(15)21/h2-9,11,19H,10,18H2,1H3,(H,20,23) |
| InChIKey | FAPLWNHTWBSOPO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|