C10H18N2O3S2 — CID 53464032
N'-(2-bicyclo[2.2.1]heptanylmethyl)-2-hydroxysulfonothioyloxyethanimidamide (PubChem CID 53464032) has the molecular formula C10H18N2O3S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N'-(2-bicyclo[2.2.1]heptanylmethyl)-2-hydroxysulfonothioyloxyethanimidamide.
| Compound Name | N'-(2-bicyclo[2.2.1]heptanylmethyl)-2-hydroxysulfonothioyloxyethanimidamide |
|---|---|
| PubChem CID | 53464032 |
| Molecular Formula | C10H18N2O3S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | N'-(2-bicyclo[2.2.1]heptanylmethyl)-2-hydroxysulfonothioyloxyethanimidamide |
| SMILES | N/C(COS(=O)(O)=S)=N\CC1CC2CCC1C2 |
| InChI | InChI=1S/C10H18N2O3S2/c11-10(6-15-17(13,14)16)12-5-9-4-7-1-2-8(9)3-7/h7-9H,1-6H2,(H2,11,12)(H,13,14,16) |
| InChIKey | PQGFVOURRHRXKN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|