C9H16N2O3S2 — CID 92970667
(1S,2S,4R)-2-[(1-amino-2-sulfosulfanylethylidene)amino]bicyclo[2.2.1]heptane (PubChem CID 92970667) has the molecular formula C9H16N2O3S2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (1S,2S,4R)-2-[(1-amino-2-sulfosulfanylethylidene)amino]bicyclo[2.2.1]heptane.
| Compound Name | (1S,2S,4R)-2-[(1-amino-2-sulfosulfanylethylidene)amino]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 92970667 |
| Molecular Formula | C9H16N2O3S2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | (1S,2S,4R)-2-[(1-amino-2-sulfosulfanylethylidene)amino]bicyclo[2.2.1]heptane |
| SMILES | N/C(CSS(=O)(=O)O)=N\[C@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C9H16N2O3S2/c10-9(5-15-16(12,13)14)11-8-4-6-1-2-7(8)3-6/h6-8H,1-5H2,(H2,10,11)(H,12,13,14)/t6-,7+,8+/m1/s1 |
| InChIKey | MTXZZJCYHSYXTB-CSMHCCOUSA-N |
| XLogP | 1.07 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|