C8H14O3 — CID 53465925
(3R,3aS,5R,6aR)-3-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol (PubChem CID 53465925) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (3R,3aS,5R,6aR)-3-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol.
| Compound Name | (3R,3aS,5R,6aR)-3-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol |
|---|---|
| PubChem CID | 53465925 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (3R,3aS,5R,6aR)-3-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol |
| SMILES | CO[C@H]1CO[C@@H]2C[C@H](O)C[C@H]12 |
| InChI | InChI=1S/C8H14O3/c1-10-8-4-11-7-3-5(9)2-6(7)8/h5-9H,2-4H2,1H3/t5-,6+,7-,8+/m1/s1 |
| InChIKey | WBXCGIGADAMULK-CWKFCGSDSA-N |
| XLogP | 0.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |