C13H12Cl2O2 — CID 53467478
[(1Z)-2-chloro-1-(2-chlorophenyl)penta-1,4-dienyl] acetate (PubChem CID 53467478) has the molecular formula C13H12Cl2O2 and a molecular weight of 271.14 g/mol. Its IUPAC name is [(1Z)-2-chloro-1-(2-chlorophenyl)penta-1,4-dienyl] acetate.
| Compound Name | [(1Z)-2-chloro-1-(2-chlorophenyl)penta-1,4-dienyl] acetate |
|---|---|
| PubChem CID | 53467478 |
| Molecular Formula | C13H12Cl2O2 |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | [(1Z)-2-chloro-1-(2-chlorophenyl)penta-1,4-dienyl] acetate |
| SMILES | C=CC/C(Cl)=C(/OC(C)=O)c1ccccc1Cl |
| InChI | InChI=1S/C13H12Cl2O2/c1-3-6-12(15)13(17-9(2)16)10-7-4-5-8-11(10)14/h3-5,7-8H,1,6H2,2H3/b13-12- |
| InChIKey | UGHQEGHORGRCIF-SEYXRHQNSA-N |
| XLogP | 4.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|