C15H25NO7 — CID 53469340
triethyl (2R,4R)-4-methoxy-1-methylpyrrolidine-2,3,3-tricarboxylate (PubChem CID 53469340) has the molecular formula C15H25NO7 and a molecular weight of 331.37 g/mol. Its IUPAC name is triethyl (2R,4R)-4-methoxy-1-methylpyrrolidine-2,3,3-tricarboxylate.
| Compound Name | triethyl (2R,4R)-4-methoxy-1-methylpyrrolidine-2,3,3-tricarboxylate |
|---|---|
| PubChem CID | 53469340 |
| Molecular Formula | C15H25NO7 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | triethyl (2R,4R)-4-methoxy-1-methylpyrrolidine-2,3,3-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1N(C)C[C@H](OC)C1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C15H25NO7/c1-6-21-12(17)11-15(13(18)22-7-2,14(19)23-8-3)10(20-5)9-16(11)4/h10-11H,6-9H2,1-5H3/t10-,11-/m0/s1 |
| InChIKey | VDOYMVDEJLSZFC-QWRGUYRKSA-N |
| XLogP | -0.01 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|