C17H17N3O — CID 53474487
(3S)-7-(1-benzyltriazol-4-yl)-2-methylhepta-4,6-diyn-3-ol (PubChem CID 53474487) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is (3S)-7-(1-benzyltriazol-4-yl)-2-methylhepta-4,6-diyn-3-ol.
| Compound Name | (3S)-7-(1-benzyltriazol-4-yl)-2-methylhepta-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 53474487 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (3S)-7-(1-benzyltriazol-4-yl)-2-methylhepta-4,6-diyn-3-ol |
| SMILES | CC(C)[C@H](O)C#CC#Cc1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C17H17N3O/c1-14(2)17(21)11-7-6-10-16-13-20(19-18-16)12-15-8-4-3-5-9-15/h3-5,8-9,13-14,17,21H,12H2,1-2H3/t17-/m1/s1 |
| InChIKey | LBDJVZXCZAIMJX-QGZVFWFLSA-N |
| XLogP | 1.70 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|