C18H27N5O15P2 — CID 53474800
[(3R,4R,5R)-5-[[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-2,4-dihydroxyoxolan-3-yl] propanoate (PubChem CID 53474800) has the molecular formula C18H27N5O15P2 and a molecular weight of 615.38 g/mol. Its IUPAC name is [(3R,4R,5R)-5-[[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-2,4-dihydroxyoxolan-3-yl] propanoate.
| Compound Name | [(3R,4R,5R)-5-[[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-2,4-dihydroxyoxolan-3-yl] propanoate |
|---|---|
| PubChem CID | 53474800 |
| Molecular Formula | C18H27N5O15P2 |
| Molecular Weight | 615.38 g/mol |
| Exact Mass | 615.10 |
| IUPAC Name | [(3R,4R,5R)-5-[[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-2,4-dihydroxyoxolan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1C(O)O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)[C@H]1O |
| InChI | InChI=1S/C18H27N5O15P2/c1-2-9(24)37-14-12(26)8(36-18(14)28)4-34-40(31,32)38-39(29,30)33-3-7-11(25)13(27)17(35-7)23-6-22-10-15(19)20-5-21-16(10)23/h5-8,11-14,17-18,25-28H,2-4H2,1H3,(H,29,30)(H,31,32)(H2,19,20,21)/t7-,8-,11-,12-,13-,14-,17-,18?/m1/s1 |
| InChIKey | ZEPYWNDVGMFLHJ-PMJZGJRDSA-N |
| XLogP | -2.32 |
| TPSA | 297.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.38 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|