C21H33N5O15P2 — CID 53475137
[(2R,3S,4R)-2-[[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-4,5-dihydroxyoxolan-3-yl] hexanoate (PubChem CID 53475137) has the molecular formula C21H33N5O15P2 and a molecular weight of 657.46 g/mol. Its IUPAC name is [(2R,3S,4R)-2-[[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-4,5-dihydroxyoxolan-3-yl] hexanoate.
| Compound Name | [(2R,3S,4R)-2-[[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-4,5-dihydroxyoxolan-3-yl] hexanoate |
|---|---|
| PubChem CID | 53475137 |
| Molecular Formula | C21H33N5O15P2 |
| Molecular Weight | 657.46 g/mol |
| Exact Mass | 657.14 |
| IUPAC Name | [(2R,3S,4R)-2-[[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-4,5-dihydroxyoxolan-3-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)OC(O)[C@@H]1O |
| InChI | InChI=1S/C21H33N5O15P2/c1-2-3-4-5-12(27)40-17-11(39-21(31)16(17)30)7-37-43(34,35)41-42(32,33)36-6-10-14(28)15(29)20(38-10)26-9-25-13-18(22)23-8-24-19(13)26/h8-11,14-17,20-21,28-31H,2-7H2,1H3,(H,32,33)(H,34,35)(H2,22,23,24)/t10-,11-,14-,15-,16-,17-,20-,21?/m1/s1 |
| InChIKey | OGICDBUGWZYQKF-XOIFJVBMSA-N |
| XLogP | -1.15 |
| TPSA | 297.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.46 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|