C15H10F3N2 — CID 53474983
CID 53474983 (PubChem CID 53474983) has the molecular formula C15H10F3N2 and a molecular weight of 275.25 g/mol.
| Compound Name | CID 53474983 |
|---|---|
| PubChem CID | 53474983 |
| Molecular Formula | C15H10F3N2 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1ccc(N/N=C\C#C[C]2[CH][CH][CH][CH]2)cc1 |
| InChI | InChI=1S/C15H10F3N2/c16-15(17,18)13-7-9-14(10-8-13)20-19-11-3-6-12-4-1-2-5-12/h1-2,4-5,7-11,20H/b19-11- |
| InChIKey | AAKUSLHYWXPDIU-ODLFYWEKSA-N |
| XLogP | 3.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|