C43H85N4O12PS — CID 53476436
2-[2-[2-[2-[[(2R)-3-[(2R)-2,3-bis(decylcarbamoyloxy)propyl]sulfanyl-2-(heptanoylamino)propanoyl]amino]ethoxy]ethoxy]ethoxy]ethylphosphonic acid (PubChem CID 53476436) has the molecular formula C43H85N4O12PS and a molecular weight of 913.21 g/mol. Its IUPAC name is 2-[2-[2-[2-[[(2R)-3-[(2R)-2,3-bis(decylcarbamoyloxy)propyl]sulfanyl-2-(heptanoylamino)propanoyl]amino]ethoxy]ethoxy]ethoxy]ethylphosphonic acid.
| Compound Name | 2-[2-[2-[2-[[(2R)-3-[(2R)-2,3-bis(decylcarbamoyloxy)propyl]sulfanyl-2-(heptanoylamino)propanoyl]amino]ethoxy]ethoxy]ethoxy]ethylphosphonic acid |
|---|---|
| PubChem CID | 53476436 |
| Molecular Formula | C43H85N4O12PS |
| Molecular Weight | 913.21 g/mol |
| Exact Mass | 912.56 |
| IUPAC Name | 2-[2-[2-[2-[[(2R)-3-[(2R)-2,3-bis(decylcarbamoyloxy)propyl]sulfanyl-2-(heptanoylamino)propanoyl]amino]ethoxy]ethoxy]ethoxy]ethylphosphonic acid |
| SMILES | CCCCCCCCCCNC(=O)OC[C@H](CSC[C@H](NC(=O)CCCCCC)C(=O)NCCOCCOCCOCCP(=O)(O)O)OC(=O)NCCCCCCCCCC |
| InChI | InChI=1S/C43H85N4O12PS/c1-4-7-10-13-15-17-19-22-25-45-42(50)58-35-38(59-43(51)46-26-23-20-18-16-14-11-8-5-2)36-61-37-39(47-40(48)24-21-12-9-6-3)41(49)44-27-28-55-29-30-56-31-32-57-33-34-60(52,53)54/h38-39H,4-37H2,1-3H3,(H,44,49)(H,45,50)(H,46,51)(H,47,48)(H2,52,53,54)/t38-,39+/m1/s1 |
| InChIKey | KTMZNCMWJWOOMA-RGULYWFUSA-N |
| XLogP | 7.62 |
| TPSA | 220.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.21 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|