C18H25NO2 — CID 53483425
(6S,8S,9aR)-8-methyl-6-(phenylmethoxymethyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one (PubChem CID 53483425) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is (6S,8S,9aR)-8-methyl-6-(phenylmethoxymethyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one.
| Compound Name | (6S,8S,9aR)-8-methyl-6-(phenylmethoxymethyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
|---|---|
| PubChem CID | 53483425 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (6S,8S,9aR)-8-methyl-6-(phenylmethoxymethyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
| SMILES | C[C@H]1C[C@H]2CCCC(=O)N2[C@H](COCc2ccccc2)C1 |
| InChI | InChI=1S/C18H25NO2/c1-14-10-16-8-5-9-18(20)19(16)17(11-14)13-21-12-15-6-3-2-4-7-15/h2-4,6-7,14,16-17H,5,8-13H2,1H3/t14-,16+,17-/m0/s1 |
| InChIKey | FRZPSFOGJLPETI-UAGQMJEPSA-N |
| XLogP | 3.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |