C12H12BrF2NO2 — CID 53484361
(E)-7-bromo-N-(2,2-difluoroethoxy)-3,4-dihydro-2H-1-benzoxepin-5-imine (PubChem CID 53484361) has the molecular formula C12H12BrF2NO2 and a molecular weight of 320.13 g/mol. Its IUPAC name is (E)-7-bromo-N-(2,2-difluoroethoxy)-3,4-dihydro-2H-1-benzoxepin-5-imine.
| Compound Name | (E)-7-bromo-N-(2,2-difluoroethoxy)-3,4-dihydro-2H-1-benzoxepin-5-imine |
|---|---|
| PubChem CID | 53484361 |
| Molecular Formula | C12H12BrF2NO2 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | (E)-7-bromo-N-(2,2-difluoroethoxy)-3,4-dihydro-2H-1-benzoxepin-5-imine |
| SMILES | FC(F)CO/N=C1\CCCOc2ccc(Br)cc21 |
| InChI | InChI=1S/C12H12BrF2NO2/c13-8-3-4-11-9(6-8)10(2-1-5-17-11)16-18-7-12(14)15/h3-4,6,12H,1-2,5,7H2/b16-10+ |
| InChIKey | HECWEZUQMFXEAB-MHWRWJLKSA-N |
| XLogP | 3.61 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|