C16H24BrClN2O2 — CID 6509906
2-[(Z)-(7-bromo-3,4-dihydro-2H-1-benzoxepin-5-ylidene)amino]oxy-N,N-diethylethanamine;hydrochloride (PubChem CID 6509906) has the molecular formula C16H24BrClN2O2 and a molecular weight of 391.74 g/mol. Its IUPAC name is 2-[(Z)-(7-bromo-3,4-dihydro-2H-1-benzoxepin-5-ylidene)amino]oxy-N,N-diethylethanamine;hydrochloride.
| Compound Name | 2-[(Z)-(7-bromo-3,4-dihydro-2H-1-benzoxepin-5-ylidene)amino]oxy-N,N-diethylethanamine;hydrochloride |
|---|---|
| PubChem CID | 6509906 |
| Molecular Formula | C16H24BrClN2O2 |
| Molecular Weight | 391.74 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-[(Z)-(7-bromo-3,4-dihydro-2H-1-benzoxepin-5-ylidene)amino]oxy-N,N-diethylethanamine;hydrochloride |
| SMILES | CCN(CC)CCO/N=C1/CCCOc2ccc(Br)cc21.Cl |
| InChI | InChI=1S/C16H23BrN2O2.ClH/c1-3-19(4-2)9-11-21-18-15-6-5-10-20-16-8-7-13(17)12-14(15)16;/h7-8,12H,3-6,9-11H2,1-2H3;1H/b18-15-; |
| InChIKey | JZJDZVLQORGTLL-MWIGPOFTSA-N |
| XLogP | 4.11 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|