C15H20BrN3O — CID 167766293
(Z)-8-bromo-N-(4-methylpiperazin-1-yl)-3,4-dihydro-2H-1-benzoxepin-5-imine (PubChem CID 167766293) has the molecular formula C15H20BrN3O and a molecular weight of 338.25 g/mol. Its IUPAC name is (Z)-8-bromo-N-(4-methylpiperazin-1-yl)-3,4-dihydro-2H-1-benzoxepin-5-imine.
| Compound Name | (Z)-8-bromo-N-(4-methylpiperazin-1-yl)-3,4-dihydro-2H-1-benzoxepin-5-imine |
|---|---|
| PubChem CID | 167766293 |
| Molecular Formula | C15H20BrN3O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (Z)-8-bromo-N-(4-methylpiperazin-1-yl)-3,4-dihydro-2H-1-benzoxepin-5-imine |
| SMILES | CN1CCN(/N=C2/CCCOc3cc(Br)ccc32)CC1 |
| InChI | InChI=1S/C15H20BrN3O/c1-18-6-8-19(9-7-18)17-14-3-2-10-20-15-11-12(16)4-5-13(14)15/h4-5,11H,2-3,6-10H2,1H3/b17-14- |
| InChIKey | NGJMKJPNNQRDLW-VKAVYKQESA-N |
| XLogP | 2.57 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|