About 1-chloroindeno[2,1-c]pyridin-9-one
1-chloroindeno[2,1-c]pyridin-9-one (PubChem CID 53485893) has the molecular formula C12H6ClNO
and a molecular weight of 215.64 g/mol. Its IUPAC name is 1-chloroindeno[2,1-c]pyridin-9-one.
Molecular Properties
| Compound Name | 1-chloroindeno[2,1-c]pyridin-9-one |
| PubChem CID | 53485893 |
| Molecular Formula | C12H6ClNO |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | 1-chloroindeno[2,1-c]pyridin-9-one |
| SMILES | O=C1c2ccccc2-c2ccnc(Cl)c21 |
| InChI | InChI=1S/C12H6ClNO/c13-12-10-8(5-6-14-12)7-3-1-2-4-9(7)11(10)15/h1-6H |
| InChIKey | RWNMCMIMSZBPPE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroindeno[2,1-c]pyridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroindeno[2,1-c]pyridin-9-one?
The IUPAC name of 1-chloroindeno[2,1-c]pyridin-9-one (CID 53485893) is 1-chloroindeno[2,1-c]pyridin-9-one.
What is the SMILES notation for 1-chloroindeno[2,1-c]pyridin-9-one?
The canonical SMILES for 1-chloroindeno[2,1-c]pyridin-9-one is O=C1c2ccccc2-c2ccnc(Cl)c21.
What is the InChIKey of 1-chloroindeno[2,1-c]pyridin-9-one?
The InChIKey is RWNMCMIMSZBPPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6ClNO/c13-12-10-8(5-6-14-12)7-3-1-2-4-9(7)11(10)15/h1-6H.
What are the key properties of 1-chloroindeno[2,1-c]pyridin-9-one?
1-chloroindeno[2,1-c]pyridin-9-one has a molecular weight of 215.64 g/mol, XLogP of 2.95, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroindeno[2,1-c]pyridin-9-one is sourced from PubChem (CID 53485893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).