C14H23N7O4 — CID 53492412
(2S)-2-[3-[[2-[carbamimidoyl(methyl)amino]acetyl]amino]propanoylamino]-3-(3-methylimidazol-4-yl)propanoic acid (PubChem CID 53492412) has the molecular formula C14H23N7O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is (2S)-2-[3-[[2-[carbamimidoyl(methyl)amino]acetyl]amino]propanoylamino]-3-(3-methylimidazol-4-yl)propanoic acid.
| Compound Name | (2S)-2-[3-[[2-[carbamimidoyl(methyl)amino]acetyl]amino]propanoylamino]-3-(3-methylimidazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 53492412 |
| Molecular Formula | C14H23N7O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (2S)-2-[3-[[2-[carbamimidoyl(methyl)amino]acetyl]amino]propanoylamino]-3-(3-methylimidazol-4-yl)propanoic acid |
| SMILES | [H]/N=C(\N)N(C)CC(=O)NCCC(=O)N[C@@H](Cc1cncn1C)C(=O)O |
| InChI | InChI=1S/C14H23N7O4/c1-20(14(15)16)7-12(23)18-4-3-11(22)19-10(13(24)25)5-9-6-17-8-21(9)2/h6,8,10H,3-5,7H2,1-2H3,(H3,15,16)(H,18,23)(H,19,22)(H,24,25)/t10-/m0/s1 |
| InChIKey | OEEMWKDNEYOAOW-JTQLQIEISA-N |
| XLogP | -2.14 |
| TPSA | 166.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|