C22H35BrO5 — CID 53493278
(4E,6S,7R,8S,9R,10Z,12Z,14R,15R,16E)-17-bromo-7,9,15-trihydroxy-5,6,8,14,16-pentamethylheptadeca-4,10,12,16-tetraenoic acid (PubChem CID 53493278) has the molecular formula C22H35BrO5 and a molecular weight of 459.42 g/mol. Its IUPAC name is (4E,6S,7R,8S,9R,10Z,12Z,14R,15R,16E)-17-bromo-7,9,15-trihydroxy-5,6,8,14,16-pentamethylheptadeca-4,10,12,16-tetraenoic acid.
| Compound Name | (4E,6S,7R,8S,9R,10Z,12Z,14R,15R,16E)-17-bromo-7,9,15-trihydroxy-5,6,8,14,16-pentamethylheptadeca-4,10,12,16-tetraenoic acid |
|---|---|
| PubChem CID | 53493278 |
| Molecular Formula | C22H35BrO5 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (4E,6S,7R,8S,9R,10Z,12Z,14R,15R,16E)-17-bromo-7,9,15-trihydroxy-5,6,8,14,16-pentamethylheptadeca-4,10,12,16-tetraenoic acid |
| SMILES | C/C(=C\CCC(=O)O)[C@H](C)[C@@H](O)[C@@H](C)[C@H](O)/C=C\C=C/[C@@H](C)[C@@H](O)/C(C)=C/Br |
| InChI | InChI=1S/C22H35BrO5/c1-14(10-8-12-20(25)26)17(4)22(28)18(5)19(24)11-7-6-9-15(2)21(27)16(3)13-23/h6-7,9-11,13,15,17-19,21-22,24,27-28H,8,12H2,1-5H3,(H,25,26)/b9-6-,11-7-,14-10+,16-13+/t15-,17+,18+,19-,21-,22-/m1/s1 |
| InChIKey | MDDQQHGFWPPXLS-OXATZGGRSA-N |
| XLogP | 4.20 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|