C33H58O2Si2 — CID 53495441
tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(5,5,5-tritritiopentyl)phenoxy]-dimethylsilane (PubChem CID 53495441) has the molecular formula C33H58O2Si2 and a molecular weight of 549.02 g/mol. Its IUPAC name is tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(5,5,5-tritritiopentyl)phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(5,5,5-tritritiopentyl)phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 53495441 |
| Molecular Formula | C33H58O2Si2 |
| Molecular Weight | 549.02 g/mol |
| Exact Mass | 548.42 |
| IUPAC Name | tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(5,5,5-tritritiopentyl)phenoxy]-dimethylsilane |
| SMILES | [3H]C([3H])([3H])CCCCc1cc(O[Si](C)(C)C(C)(C)C)cc(O[Si](C)(C)C(C)(C)C)c1[C@@H]1C=C(C)CC[C@H]1C(=C)C |
| InChI | InChI=1S/C33H58O2Si2/c1-15-16-17-18-26-22-27(34-36(11,12)32(5,6)7)23-30(35-37(13,14)33(8,9)10)31(26)29-21-25(4)19-20-28(29)24(2)3/h21-23,28-29H,2,15-20H2,1,3-14H3/t28-,29+/m0/s1/i1T3 |
| InChIKey | QTDLVFRKSGMLSH-QHRPQVDRSA-N |
| XLogP | 11.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.02 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|