C32H55BrO2Si2 — CID 53495680
[3-(4-bromobutyl)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenoxy]-tert-butyl-dimethylsilane (PubChem CID 53495680) has the molecular formula C32H55BrO2Si2 and a molecular weight of 607.87 g/mol. Its IUPAC name is [3-(4-bromobutyl)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenoxy]-tert-butyl-dimethylsilane.
| Compound Name | [3-(4-bromobutyl)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 53495680 |
| Molecular Formula | C32H55BrO2Si2 |
| Molecular Weight | 607.87 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | [3-(4-bromobutyl)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenoxy]-tert-butyl-dimethylsilane |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(CCCCBr)cc(O[Si](C)(C)C(C)(C)C)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H55BrO2Si2/c1-23(2)27-18-17-24(3)20-28(27)30-25(16-14-15-19-33)21-26(34-36(10,11)31(4,5)6)22-29(30)35-37(12,13)32(7,8)9/h20-22,27-28H,1,14-19H2,2-13H3/t27-,28+/m0/s1 |
| InChIKey | LJEPIKJQJFFRRH-WUFINQPMSA-N |
| XLogP | 11.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.87 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|