C35H39FN4O2S — CID 53496189
1,2-dicyclohexyl-1-(6-fluoro-3-phenylisoquinolin-1-yl)-3-(4-methylphenyl)sulfonylguanidine (PubChem CID 53496189) has the molecular formula C35H39FN4O2S and a molecular weight of 598.79 g/mol. Its IUPAC name is 1,2-dicyclohexyl-1-(6-fluoro-3-phenylisoquinolin-1-yl)-3-(4-methylphenyl)sulfonylguanidine.
| Compound Name | 1,2-dicyclohexyl-1-(6-fluoro-3-phenylisoquinolin-1-yl)-3-(4-methylphenyl)sulfonylguanidine |
|---|---|
| PubChem CID | 53496189 |
| Molecular Formula | C35H39FN4O2S |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 1,2-dicyclohexyl-1-(6-fluoro-3-phenylisoquinolin-1-yl)-3-(4-methylphenyl)sulfonylguanidine |
| SMILES | Cc1ccc(S(=O)(=O)N/C(=N\C2CCCCC2)N(c2nc(-c3ccccc3)cc3cc(F)ccc23)C2CCCCC2)cc1 |
| InChI | InChI=1S/C35H39FN4O2S/c1-25-17-20-31(21-18-25)43(41,42)39-35(37-29-13-7-3-8-14-29)40(30-15-9-4-10-16-30)34-32-22-19-28(36)23-27(32)24-33(38-34)26-11-5-2-6-12-26/h2,5-6,11-12,17-24,29-30H,3-4,7-10,13-16H2,1H3,(H,37,39) |
| InChIKey | CYADYLBKGAWZDY-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|