C29H31ClN4O2S — CID 53496309
1-(7-chloro-3-phenylisoquinolin-1-yl)-3-(4-methylphenyl)sulfonyl-1,2-di(propan-2-yl)guanidine (PubChem CID 53496309) has the molecular formula C29H31ClN4O2S and a molecular weight of 535.11 g/mol. Its IUPAC name is 1-(7-chloro-3-phenylisoquinolin-1-yl)-3-(4-methylphenyl)sulfonyl-1,2-di(propan-2-yl)guanidine.
| Compound Name | 1-(7-chloro-3-phenylisoquinolin-1-yl)-3-(4-methylphenyl)sulfonyl-1,2-di(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 53496309 |
| Molecular Formula | C29H31ClN4O2S |
| Molecular Weight | 535.11 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 1-(7-chloro-3-phenylisoquinolin-1-yl)-3-(4-methylphenyl)sulfonyl-1,2-di(propan-2-yl)guanidine |
| SMILES | Cc1ccc(S(=O)(=O)N/C(=N\C(C)C)N(c2nc(-c3ccccc3)cc3ccc(Cl)cc23)C(C)C)cc1 |
| InChI | InChI=1S/C29H31ClN4O2S/c1-19(2)31-29(33-37(35,36)25-15-11-21(5)12-16-25)34(20(3)4)28-26-18-24(30)14-13-23(26)17-27(32-28)22-9-7-6-8-10-22/h6-20H,1-5H3,(H,31,33) |
| InChIKey | WRGFCFKOGFBQHA-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.11 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|