C25H24N2O3S — CID 132938718
4-methyl-N-[2-(2-phenylquinolin-4-yl)oxypropyl]benzenesulfonamide (PubChem CID 132938718) has the molecular formula C25H24N2O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is 4-methyl-N-[2-(2-phenylquinolin-4-yl)oxypropyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-(2-phenylquinolin-4-yl)oxypropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 132938718 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 4-methyl-N-[2-(2-phenylquinolin-4-yl)oxypropyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(C)Oc2cc(-c3ccccc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C25H24N2O3S/c1-18-12-14-21(15-13-18)31(28,29)26-17-19(2)30-25-16-24(20-8-4-3-5-9-20)27-23-11-7-6-10-22(23)25/h3-16,19,26H,17H2,1-2H3 |
| InChIKey | BFWUAPWLQNUDIA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |